From Wikipedia, the free encyclopedia
Chemical compound
Azepindole![](//upload.wikimedia.org/wikipedia/commons/thumb/5/5f/Azepindol.png/220px-Azepindol.png) |
|
ATC code | |
---|
|
2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
KEGG | |
---|
ChEMBL | |
---|
CompTox Dashboard (EPA) | |
---|
|
Formula | C12H14N2 |
---|
Molar mass | 186.258 g·mol−1 |
---|
3D model (JSmol) | |
---|
|
InChI=1S/C12H14N2/c1-2-5-12-10(4-1)8-11-9-13-6-3-7-14(11)12/h1-2,4-5,8,13H,3,6-7,9H2 YKey:FEJCIXJKPISCJV-UHFFFAOYSA-N Y
|
N Y (what is this?) (verify) |
Azepindole (McN-2453) is a tricyclic compound with antidepressant and antihypertensive effects that was developed in the late 1960s but was never marketed.[1]
See also[edit]
References[edit]
|
---|
|
---|
SSRIsTooltip Selective serotonin reuptake inhibitors | |
---|
SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
---|
NRIsTooltip Norepinephrine reuptake inhibitors | |
---|
NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
---|
NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
---|
SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
---|
SMSTooltip Serotonin modulator and stimulators | |
---|
Others | |
---|
|
|
|
---|
TCAsTooltip Tricyclic antidepressants | |
---|
TeCAsTooltip Tetracyclic antidepressants | |
---|
Others | |
---|
|
|
|
---|
Non-selective | |
---|
MAOATooltip Monoamine oxidase A-selective | |
---|
MAOBTooltip Monoamine oxidase B-selective | |
---|
|
|
|
|
|